C25H22N2O — CID 40544446
(4-methylphenyl)-[(1R)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 40544446) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is (4-methylphenyl)-[(1R)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (4-methylphenyl)-[(1R)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 40544446 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (4-methylphenyl)-[(1R)-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCc3c([nH]c4ccccc34)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O/c1-17-11-13-19(14-12-17)25(28)27-16-15-21-20-9-5-6-10-22(20)26-23(21)24(27)18-7-3-2-4-8-18/h2-14,24,26H,15-16H2,1H3/t24-/m1/s1 |
| InChIKey | AXJGAIRGRWPDND-XMMPIXPASA-N |
| XLogP | 5.26 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|