C26H25N3O — CID 25217359
[4-(dimethylamino)phenyl]-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone (PubChem CID 25217359) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone.
| Compound Name | [4-(dimethylamino)phenyl]-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 25217359 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [4-(dimethylamino)phenyl]-(1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
| SMILES | CN(C)c1ccc(C(=O)N2CCc3c([nH]c4ccccc34)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O/c1-28(2)20-14-12-19(13-15-20)26(30)29-17-16-22-21-10-6-7-11-23(21)27-24(22)25(29)18-8-4-3-5-9-18/h3-15,25,27H,16-17H2,1-2H3 |
| InChIKey | KMOFXGXNHRJVKC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|