C24H19FN2O — CID 92730385
[(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone (PubChem CID 92730385) has the molecular formula C24H19FN2O and a molecular weight of 370.43 g/mol. Its IUPAC name is [(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone.
| Compound Name | [(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92730385 |
| Molecular Formula | C24H19FN2O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(1R)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O/c25-18-12-10-16(11-13-18)23-22-20(19-8-4-5-9-21(19)26-22)14-15-27(23)24(28)17-6-2-1-3-7-17/h1-13,23,26H,14-15H2/t23-/m1/s1 |
| InChIKey | NMKIACQDOHUVIS-HSZRJFAPSA-N |
| XLogP | 5.09 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|