C24H19F2N3O — CID 92745415
(1S)-N,1-bis(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 92745415) has the molecular formula C24H19F2N3O and a molecular weight of 403.43 g/mol. Its IUPAC name is (1S)-N,1-bis(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | (1S)-N,1-bis(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 92745415 |
| Molecular Formula | C24H19F2N3O |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (1S)-N,1-bis(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19F2N3O/c25-16-7-5-15(6-8-16)23-22-20(19-3-1-2-4-21(19)28-22)13-14-29(23)24(30)27-18-11-9-17(26)10-12-18/h1-12,23,28H,13-14H2,(H,27,30)/t23-/m0/s1 |
| InChIKey | JCRQRQGJRWCXNB-QHCPKHFHSA-N |
| XLogP | 5.63 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|