C25H20FN3O3 — CID 50759140
N-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 50759140) has the molecular formula C25H20FN3O3 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 50759140 |
| Molecular Formula | C25H20FN3O3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)N1CCc2c([nH]c3ccccc23)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20FN3O3/c26-16-7-5-15(6-8-16)24-23-19(18-3-1-2-4-20(18)28-23)11-12-29(24)25(30)27-17-9-10-21-22(13-17)32-14-31-21/h1-10,13,24,28H,11-12,14H2,(H,27,30) |
| InChIKey | IISZBJYOQZHBAX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|