C26H22N2O4 — CID 50805950
1,3-benzodioxol-5-yl-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 50805950) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 50805950 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-30-18-9-6-16(7-10-18)25-24-20(19-4-2-3-5-21(19)27-24)12-13-28(25)26(29)17-8-11-22-23(14-17)32-15-31-22/h2-11,14,25,27H,12-13,15H2,1H3 |
| InChIKey | YIMZSXQIZVPXGV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|