C25H20Cl2N2O2 — CID 1270683
(3,4-dichlorophenyl)-[(1S)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 1270683) has the molecular formula C25H20Cl2N2O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(1S)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(1S)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 1270683 |
| Molecular Formula | C25H20Cl2N2O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (3,4-dichlorophenyl)-[(1S)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O2/c1-31-17-9-6-15(7-10-17)24-23-19(18-4-2-3-5-22(18)28-23)12-13-29(24)25(30)16-8-11-20(26)21(27)14-16/h2-11,14,24,28H,12-13H2,1H3/t24-/m0/s1 |
| InChIKey | PMDDGHJHKVRDPS-DEOSSOPVSA-N |
| XLogP | 6.27 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|