C22H18Cl2N4O — CID 46854997
2-(4,6-dichloropyrimidin-2-yl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 46854997) has the molecular formula C22H18Cl2N4O and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-(4,6-dichloropyrimidin-2-yl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(4,6-dichloropyrimidin-2-yl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 46854997 |
| Molecular Formula | C22H18Cl2N4O |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-(4,6-dichloropyrimidin-2-yl)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CCN2c2nc(Cl)cc(Cl)n2)cc1 |
| InChI | InChI=1S/C22H18Cl2N4O/c1-29-14-8-6-13(7-9-14)21-20-16(15-4-2-3-5-17(15)25-20)10-11-28(21)22-26-18(23)12-19(24)27-22/h2-9,12,21,25H,10-11H2,1H3 |
| InChIKey | QJVPLPZFLYTWJW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|