C25H22N2O2 — CID 87562467
4-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]benzaldehyde (PubChem CID 87562467) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]benzaldehyde.
| Compound Name | 4-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 87562467 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]benzaldehyde |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CCN2c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O2/c1-29-20-12-8-18(9-13-20)25-24-22(21-4-2-3-5-23(21)26-24)14-15-27(25)19-10-6-17(16-28)7-11-19/h2-13,16,25-26H,14-15H2,1H3 |
| InChIKey | ADFXCSWXHCNULQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|