C21H24N2O3 — CID 145496027
ethoxy-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanol (PubChem CID 145496027) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethoxy-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanol.
| Compound Name | ethoxy-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanol |
|---|---|
| PubChem CID | 145496027 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethoxy-[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanol |
| SMILES | CCOC(O)N1CCc2c([nH]c3ccccc23)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-3-26-21(24)23-13-12-17-16-6-4-5-7-18(16)22-19(17)20(23)14-8-10-15(25-2)11-9-14/h4-11,20-22,24H,3,12-13H2,1-2H3 |
| InChIKey | NQZRTTSZKLFZPX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|