C22H24N2O2 — CID 92730443
1-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one (PubChem CID 92730443) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one.
| Compound Name | 1-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 92730443 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[(1R)-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-6-20(25)24-14-13-18-17-7-4-5-8-19(17)23-21(18)22(24)15-9-11-16(26-2)12-10-15/h4-5,7-12,22-23H,3,6,13-14H2,1-2H3/t22-/m1/s1 |
| InChIKey | YUKLURDTBQUOIO-JOCHJYFZSA-N |
| XLogP | 4.45 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|