C25H28N2O3 — CID 126738731
methyl 4-(2-hexanoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate (PubChem CID 126738731) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 4-(2-hexanoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate.
| Compound Name | methyl 4-(2-hexanoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate |
|---|---|
| PubChem CID | 126738731 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | methyl 4-(2-hexanoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate |
| SMILES | CCCCCC(=O)N1CCc2c([nH]c3ccccc23)C1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-3-4-5-10-22(28)27-16-15-20-19-8-6-7-9-21(19)26-23(20)24(27)17-11-13-18(14-12-17)25(29)30-2/h6-9,11-14,24,26H,3-5,10,15-16H2,1-2H3 |
| InChIKey | JWDSIKGOTCZWLT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|