C27H25N3O4 — CID 50759104
methyl 3-[[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate (PubChem CID 50759104) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is methyl 3-[[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 50759104 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | methyl 3-[[1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2CCc3c([nH]c4ccccc34)C2c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C27H25N3O4/c1-33-20-12-10-17(11-13-20)25-24-22(21-8-3-4-9-23(21)29-24)14-15-30(25)27(32)28-19-7-5-6-18(16-19)26(31)34-2/h3-13,16,25,29H,14-15H2,1-2H3,(H,28,32) |
| InChIKey | COOHAFDGHATFCV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|