C29H29N3O4 — CID 92745571
ethyl 3-[[(1S)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate (PubChem CID 92745571) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is ethyl 3-[[(1S)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(1S)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 92745571 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | ethyl 3-[[(1S)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)N2CCc3c([nH]c4ccc(OC)cc34)[C@@H]2c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C29H29N3O4/c1-4-36-28(33)20-6-5-7-21(16-20)30-29(34)32-15-14-23-24-17-22(35-3)12-13-25(24)31-26(23)27(32)19-10-8-18(2)9-11-19/h5-13,16-17,27,31H,4,14-15H2,1-3H3,(H,30,34)/t27-/m0/s1 |
| InChIKey | CYXQAVPKHSIMAU-MHZLTWQESA-N |
| XLogP | 5.84 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|