C27H26FN3O3 — CID 50759052
N-(4-ethoxyphenyl)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 50759052) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 50759052 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CCc3c([nH]c4ccc(OC)cc34)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H26FN3O3/c1-3-34-20-10-8-19(9-11-20)29-27(32)31-15-14-22-23-16-21(33-2)12-13-24(23)30-25(22)26(31)17-4-6-18(28)7-5-17/h4-13,16,26,30H,3,14-15H2,1-2H3,(H,29,32) |
| InChIKey | XQHKLNDPEXCUGQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|