C22H23FN2O2 — CID 92734709
1-[(1S)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one (PubChem CID 92734709) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-[(1S)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one.
| Compound Name | 1-[(1S)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
|---|---|
| PubChem CID | 92734709 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[(1S)-1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2c([nH]c3ccc(OC)cc23)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O2/c1-3-4-20(26)25-12-11-17-18-13-16(27-2)9-10-19(18)24-21(17)22(25)14-5-7-15(23)8-6-14/h5-10,13,22,24H,3-4,11-12H2,1-2H3/t22-/m0/s1 |
| InChIKey | HBBQJNUEGKOVQG-QFIPXVFZSA-N |
| XLogP | 4.59 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|