C28H25F3N2O3 — CID 92820559
1-[(1S)-6-methoxy-1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylmethoxyethanone (PubChem CID 92820559) has the molecular formula C28H25F3N2O3 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-[(1S)-6-methoxy-1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[(1S)-6-methoxy-1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 92820559 |
| Molecular Formula | C28H25F3N2O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1-[(1S)-6-methoxy-1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-phenylmethoxyethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)COCc1ccccc1)[C@H]3c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H25F3N2O3/c1-35-21-11-12-24-23(15-21)22-13-14-33(25(34)17-36-16-18-5-3-2-4-6-18)27(26(22)32-24)19-7-9-20(10-8-19)28(29,30)31/h2-12,15,27,32H,13-14,16-17H2,1H3/t27-/m0/s1 |
| InChIKey | YPJYKXJDYALVDS-MHZLTWQESA-N |
| XLogP | 5.89 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|