C29H38N2O3 — CID 46102988
1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3,5,5-trimethylhexan-1-one (PubChem CID 46102988) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 46102988 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3,5,5-trimethylhexan-1-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)CC(C)CC(C)(C)C)C3COCc1ccccc1 |
| InChI | InChI=1S/C29H38N2O3/c1-20(17-29(2,3)4)15-27(32)31-14-13-23-24-16-22(33-5)11-12-25(24)30-28(23)26(31)19-34-18-21-9-7-6-8-10-21/h6-12,16,20,26,30H,13-15,17-19H2,1-5H3 |
| InChIKey | LDPJPQYRHSZPJU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|