C30H29F3N2O2 — CID 145487690
1-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-phenylpropan-2-one (PubChem CID 145487690) has the molecular formula C30H29F3N2O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 1-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-phenylpropan-2-one.
| Compound Name | 1-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 145487690 |
| Molecular Formula | C30H29F3N2O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-[6-methoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-1-phenylpropan-2-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(C(C)=O)c1ccccc1)C3CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H29F3N2O2/c1-19(36)29(21-6-4-3-5-7-21)35-17-16-24-25-18-23(37-2)13-14-26(25)34-28(24)27(35)15-10-20-8-11-22(12-9-20)30(31,32)33/h3-9,11-14,18,27,29,34H,10,15-17H2,1-2H3 |
| InChIKey | YRKDNWVSBTWAFG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|