C28H31F3N2O4 — CID 92773023
ethyl 7-[(1R)-6-methoxy-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate (PubChem CID 92773023) has the molecular formula C28H31F3N2O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is ethyl 7-[(1R)-6-methoxy-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate.
| Compound Name | ethyl 7-[(1R)-6-methoxy-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 92773023 |
| Molecular Formula | C28H31F3N2O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | ethyl 7-[(1R)-6-methoxy-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N1CCc2c([nH]c3ccc(OC)cc23)[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H31F3N2O4/c1-3-37-25(35)11-6-4-5-10-24(34)33-15-14-21-22-17-20(36-2)12-13-23(22)32-26(21)27(33)18-8-7-9-19(16-18)28(29,30)31/h7-9,12-13,16-17,27,32H,3-6,10-11,14-15H2,1-2H3/t27-/m1/s1 |
| InChIKey | BOXDDFNSLLMOAX-HHHXNRCGSA-N |
| XLogP | 6.18 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|