C32H33F3N2O5 — CID 46103032
ethyl 7-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate (PubChem CID 46103032) has the molecular formula C32H33F3N2O5 and a molecular weight of 582.62 g/mol. Its IUPAC name is ethyl 7-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate.
| Compound Name | ethyl 7-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 46103032 |
| Molecular Formula | C32H33F3N2O5 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | ethyl 7-[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N1CCc2c([nH]c3ccc(OC)cc23)C1c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C32H33F3N2O5/c1-3-41-29(39)12-6-4-5-11-28(38)37-18-17-21-23-19-20(40-2)13-14-25(23)36-30(21)31(37)27-16-15-26(42-27)22-9-7-8-10-24(22)32(33,34)35/h7-10,13-16,19,31,36H,3-6,11-12,17-18H2,1-2H3 |
| InChIKey | ZIIIGDFQDYGUOM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 84.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|