C28H28N2O6 — CID 46102953
[5-[6-methoxy-2-(2-phenylmethoxyacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]furan-2-yl]methyl acetate (PubChem CID 46102953) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [5-[6-methoxy-2-(2-phenylmethoxyacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]furan-2-yl]methyl acetate.
| Compound Name | [5-[6-methoxy-2-(2-phenylmethoxyacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46102953 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [5-[6-methoxy-2-(2-phenylmethoxyacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]furan-2-yl]methyl acetate |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)COCc1ccccc1)C3c1ccc(COC(C)=O)o1 |
| InChI | InChI=1S/C28H28N2O6/c1-18(31)35-16-21-9-11-25(36-21)28-27-22(23-14-20(33-2)8-10-24(23)29-27)12-13-30(28)26(32)17-34-15-19-6-4-3-5-7-19/h3-11,14,28-29H,12-13,15-17H2,1-2H3 |
| InChIKey | GFHIYQFABYKJJE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|