C32H26ClFN2O3 — CID 98399489
(5-chloro-2-fluorophenyl)-[(1S)-6-methoxy-1-(4-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 98399489) has the molecular formula C32H26ClFN2O3 and a molecular weight of 541.02 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[(1S)-6-methoxy-1-(4-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[(1S)-6-methoxy-1-(4-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 98399489 |
| Molecular Formula | C32H26ClFN2O3 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[(1S)-6-methoxy-1-(4-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)c1cc(Cl)ccc1F)[C@H]3c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H26ClFN2O3/c1-38-24-12-14-29-26(18-24)25-15-16-36(32(37)27-17-22(33)9-13-28(27)34)31(30(25)35-29)21-7-10-23(11-8-21)39-19-20-5-3-2-4-6-20/h2-14,17-18,31,35H,15-16,19H2,1H3/t31-/m0/s1 |
| InChIKey | CBTUSGLTFSWFLF-HKBQPEDESA-N |
| XLogP | 7.34 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|