C29H27ClN2O3 — CID 46102972
(E)-3-(2-chlorophenyl)-1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one (PubChem CID 46102972) has the molecular formula C29H27ClN2O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46102972 |
| Molecular Formula | C29H27ClN2O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[6-methoxy-1-(phenylmethoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)/C=C/c1ccccc1Cl)C3COCc1ccccc1 |
| InChI | InChI=1S/C29H27ClN2O3/c1-34-22-12-13-26-24(17-22)23-15-16-32(28(33)14-11-21-9-5-6-10-25(21)30)27(29(23)31-26)19-35-18-20-7-3-2-4-8-20/h2-14,17,27,31H,15-16,18-19H2,1H3/b14-11+ |
| InChIKey | FJHPJVOIBQVKOU-SDNWHVSQSA-N |
| XLogP | 6.19 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|