C22H24ClNO2 — CID 90505090
(E)-3-(2-chlorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 90505090) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90505090 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C22H24ClNO2/c23-21-11-5-4-10-20(21)12-13-22(25)24-14-6-9-19(15-24)17-26-16-18-7-2-1-3-8-18/h1-5,7-8,10-13,19H,6,9,14-17H2/b13-12+ |
| InChIKey | VPXHFUATIUOVJD-OUKQBFOZSA-N |
| XLogP | 4.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|