C21H23ClFNO2 — CID 90505258
2-(2-chloro-6-fluorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]ethanone (PubChem CID 90505258) has the molecular formula C21H23ClFNO2 and a molecular weight of 375.87 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90505258 |
| Molecular Formula | C21H23ClFNO2 |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[3-(phenylmethoxymethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCCC(COCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23ClFNO2/c22-19-9-4-10-20(23)18(19)12-21(25)24-11-5-8-17(13-24)15-26-14-16-6-2-1-3-7-16/h1-4,6-7,9-10,17H,5,8,11-15H2 |
| InChIKey | GGAWKJXQLVUBSK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |