C14H19Cl2FN2O — CID 119493667
2-(2-chloro-6-fluorophenyl)-1-[3-(methylamino)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 119493667) has the molecular formula C14H19Cl2FN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[3-(methylamino)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[3-(methylamino)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119493667 |
| Molecular Formula | C14H19Cl2FN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[3-(methylamino)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)Cc2c(F)cccc2Cl)C1.Cl |
| InChI | InChI=1S/C14H18ClFN2O.ClH/c1-17-10-4-3-7-18(9-10)14(19)8-11-12(15)5-2-6-13(11)16;/h2,5-6,10,17H,3-4,7-9H2,1H3;1H |
| InChIKey | LIQXTNDJUWONKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |