C16H23ClFN3O — CID 119919099
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-[3-(methylamino)piperidin-1-yl]acetamide (PubChem CID 119919099) has the molecular formula C16H23ClFN3O and a molecular weight of 327.83 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-[3-(methylamino)piperidin-1-yl]acetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-[3-(methylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 119919099 |
| Molecular Formula | C16H23ClFN3O |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-[3-(methylamino)piperidin-1-yl]acetamide |
| SMILES | CNC1CCCN(CC(=O)N(C)Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C16H23ClFN3O/c1-19-12-5-4-8-21(9-12)11-16(22)20(2)10-13-14(17)6-3-7-15(13)18/h3,6-7,12,19H,4-5,8-11H2,1-2H3 |
| InChIKey | GXLSFGPPDPZCHG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |