C16H19ClFN3O3 — CID 46490768
N-[(2-chloro-6-fluorophenyl)methyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide (PubChem CID 46490768) has the molecular formula C16H19ClFN3O3 and a molecular weight of 355.80 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 46490768 |
| Molecular Formula | C16H19ClFN3O3 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide |
| SMILES | CCN1CCN(CC(=O)N(C)Cc2c(F)cccc2Cl)C(=O)C1=O |
| InChI | InChI=1S/C16H19ClFN3O3/c1-3-20-7-8-21(16(24)15(20)23)10-14(22)19(2)9-11-12(17)5-4-6-13(11)18/h4-6H,3,7-10H2,1-2H3 |
| InChIKey | QMTSRXIHMUPJRY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|