C17H22ClFN2O — CID 119682892
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 119682892) has the molecular formula C17H22ClFN2O and a molecular weight of 324.83 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 119682892 |
| Molecular Formula | C17H22ClFN2O |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)CC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C17H22ClFN2O/c1-21(10-14-15(18)3-2-4-16(14)19)17(22)9-11-7-12-5-6-13(8-11)20-12/h2-4,11-13,20H,5-10H2,1H3 |
| InChIKey | OQVTTXDZWHXFIW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |