C29H30N2O4 — CID 164667160
benzyl (1R)-7-methoxy-1-[(3-oxo-8-bicyclo[3.2.1]oct-6-enyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 164667160) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is benzyl (1R)-7-methoxy-1-[(3-oxo-8-bicyclo[3.2.1]oct-6-enyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl (1R)-7-methoxy-1-[(3-oxo-8-bicyclo[3.2.1]oct-6-enyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 164667160 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | benzyl (1R)-7-methoxy-1-[(3-oxo-8-bicyclo[3.2.1]oct-6-enyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@@H](CC1C2C=CC1CC(=O)C2)N(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C29H30N2O4/c1-34-22-9-10-23-24-11-12-31(29(33)35-17-18-5-3-2-4-6-18)27(28(24)30-26(23)15-22)16-25-19-7-8-20(25)14-21(32)13-19/h2-10,15,19-20,25,27,30H,11-14,16-17H2,1H3/t19?,20?,25?,27-/m1/s1 |
| InChIKey | AGXZGKFOEJIXEI-RQYFIGPASA-N |
| XLogP | 5.58 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|