C30H31N3O5 — CID 11762984
benzyl (1S)-1-(2-methylpropyl)-7-[(2-nitrophenyl)methoxy]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 11762984) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is benzyl (1S)-1-(2-methylpropyl)-7-[(2-nitrophenyl)methoxy]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl (1S)-1-(2-methylpropyl)-7-[(2-nitrophenyl)methoxy]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11762984 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | benzyl (1S)-1-(2-methylpropyl)-7-[(2-nitrophenyl)methoxy]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)C[C@H]1c2[nH]c3cc(OCc4ccccc4[N+](=O)[O-])ccc3c2CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H31N3O5/c1-20(2)16-28-29-25(14-15-32(28)30(34)38-18-21-8-4-3-5-9-21)24-13-12-23(17-26(24)31-29)37-19-22-10-6-7-11-27(22)33(35)36/h3-13,17,20,28,31H,14-16,18-19H2,1-2H3/t28-/m0/s1 |
| InChIKey | SFCDLJMIVATXQG-NDEPHWFRSA-N |
| XLogP | 6.94 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|