C33H35N3O4 — CID 67052642
benzyl 1-[[[(1S)-2-cyclopentyloxy-2-oxo-1-phenylethyl]amino]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67052642) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is benzyl 1-[[[(1S)-2-cyclopentyloxy-2-oxo-1-phenylethyl]amino]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl 1-[[[(1S)-2-cyclopentyloxy-2-oxo-1-phenylethyl]amino]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67052642 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | benzyl 1-[[[(1S)-2-cyclopentyloxy-2-oxo-1-phenylethyl]amino]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OC1CCCC1)[C@@H](NCC1c2[nH]c3ccccc3c2CCN1C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35N3O4/c37-32(40-25-15-7-8-16-25)30(24-13-5-2-6-14-24)34-21-29-31-27(26-17-9-10-18-28(26)35-31)19-20-36(29)33(38)39-22-23-11-3-1-4-12-23/h1-6,9-14,17-18,25,29-30,34-35H,7-8,15-16,19-22H2/t29?,30-/m0/s1 |
| InChIKey | PZVFWMSGQWJAEO-ZSXSBBPPSA-N |
| XLogP | 6.22 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|