C33H42N4O5 — CID 15941545
cyclopentyl (2S)-2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methylamino]-2-phenylacetate (PubChem CID 15941545) has the molecular formula C33H42N4O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 15941545 |
| Molecular Formula | C33H42N4O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | cyclopentyl (2S)-2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methylamino]-2-phenylacetate |
| SMILES | O=C(CCCCCCC(=O)N1CCc2c([nH]c3ccccc23)C1CN[C@H](C(=O)OC1CCCC1)c1ccccc1)NO |
| InChI | InChI=1S/C33H42N4O5/c38-29(36-41)18-6-1-2-7-19-30(39)37-21-20-26-25-16-10-11-17-27(25)35-32(26)28(37)22-34-31(23-12-4-3-5-13-23)33(40)42-24-14-8-9-15-24/h3-5,10-13,16-17,24,28,31,34-35,41H,1-2,6-9,14-15,18-22H2,(H,36,38)/t28?,31-/m0/s1 |
| InChIKey | XUVIVJIZNSMTMG-JFINJBMXSA-N |
| XLogP | 5.26 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|