C28H32N4O6 — CID 140606386
2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-2-phenylacetic acid (PubChem CID 140606386) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 140606386 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-2-phenylacetic acid |
| SMILES | O=C(CCCCCCC(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)NC(C(=O)O)c1ccccc1)NO |
| InChI | InChI=1S/C28H32N4O6/c33-24(31-38)14-6-1-2-7-15-25(34)32-17-22-20(19-12-8-9-13-21(19)29-22)16-23(32)27(35)30-26(28(36)37)18-10-4-3-5-11-18/h3-5,8-13,23,26,29,38H,1-2,6-7,14-17H2,(H,30,35)(H,31,33)(H,36,37)/t23-,26?/m0/s1 |
| InChIKey | FRDBRCOLMFXFCR-ZZHFZYNASA-N |
| XLogP | 3.21 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|