C31H38N4O6 — CID 87250756
ethyl 2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoate (PubChem CID 87250756) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is ethyl 2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 87250756 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | ethyl 2-[[2-[8-(hydroxyamino)-8-oxooctanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C31H38N4O6/c1-2-41-31(39)25(18-21-12-6-5-7-13-21)33-30(38)27-19-23-22-14-10-11-15-24(22)32-26(23)20-35(27)29(37)17-9-4-3-8-16-28(36)34-40/h5-7,10-15,25,27,32,40H,2-4,8-9,16-20H2,1H3,(H,33,38)(H,34,36) |
| InChIKey | UKOWHKBIBMHIPY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|