C25H37N3O6 — CID 88946325
methyl (2S)-2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylpentanoate (PubChem CID 88946325) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 88946325 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | methyl (2S)-2-[[(3S)-2-[8-(hydroxyamino)-8-oxooctanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C25H37N3O6/c1-17(2)14-20(25(32)34-3)26-24(31)21-15-18-10-8-9-11-19(18)16-28(21)23(30)13-7-5-4-6-12-22(29)27-33/h8-11,17,20-21,33H,4-7,12-16H2,1-3H3,(H,26,31)(H,27,29)/t20-,21-/m0/s1 |
| InChIKey | UFYVYNJBXNMKDU-SFTDATJTSA-N |
| XLogP | 2.49 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|