C19H26N2O4 — CID 119170571
4-[[2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]butanoic acid (PubChem CID 119170571) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[[2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119170571 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[[2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]butanoic acid |
| SMILES | CC(C)CC(=O)N1Cc2ccccc2CC1C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C19H26N2O4/c1-13(2)10-17(22)21-12-15-7-4-3-6-14(15)11-16(21)19(25)20-9-5-8-18(23)24/h3-4,6-7,13,16H,5,8-12H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | JMSGJTDRWVTBBN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|