C21H24N2O5 — CID 119220280
6-[[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexanoic acid (PubChem CID 119220280) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 6-[[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220280 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-[[2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C1Cc2ccccc2CN1C(=O)c1ccco1 |
| InChI | InChI=1S/C21H24N2O5/c24-19(25)10-2-1-5-11-22-20(26)17-13-15-7-3-4-8-16(15)14-23(17)21(27)18-9-6-12-28-18/h3-4,6-9,12,17H,1-2,5,10-11,13-14H2,(H,22,26)(H,24,25) |
| InChIKey | QJEHEJDJCIULMK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|