C24H21F3N2O4 — CID 75893989
2-(furan-2-carbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 75893989) has the molecular formula C24H21F3N2O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-(furan-2-carbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-(furan-2-carbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 75893989 |
| Molecular Formula | C24H21F3N2O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-(furan-2-carbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)C1Cc2ccccc2CN1C(=O)c1ccco1 |
| InChI | InChI=1S/C24H21F3N2O4/c25-24(26,27)18-7-9-19(10-8-18)32-13-11-28-22(30)20-14-16-4-1-2-5-17(16)15-29(20)23(31)21-6-3-12-33-21/h1-10,12,20H,11,13-15H2,(H,28,30) |
| InChIKey | PRWMLSDSGPVZQO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|