C23H22N2O7S — CID 55399499
2-(4-sulfamoylphenoxy)ethyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 55399499) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55399499 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)C2Cc3ccccc3CN2C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H22N2O7S/c24-33(28,29)19-9-7-18(8-10-19)30-12-13-32-23(27)20-14-16-4-1-2-5-17(16)15-25(20)22(26)21-6-3-11-31-21/h1-11,20H,12-15H2,(H2,24,28,29) |
| InChIKey | LGOARAGQTZNTOC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|