C25H30ClN3O4 — CID 56514500
N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 56514500) has the molecular formula C25H30ClN3O4 and a molecular weight of 471.99 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 56514500 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-2-(3-methylbutanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)C2Cc3ccccc3CN2C(=O)CC(C)C)cc1Cl |
| InChI | InChI=1S/C25H30ClN3O4/c1-16(2)12-23(30)29-15-18-7-5-4-6-17(18)13-22(29)25(32)28-19-8-9-20(21(26)14-19)24(31)27-10-11-33-3/h4-9,14,16,22H,10-13,15H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | IJWRQYXXUVVALE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|