C23H24Cl2N4O3 — CID 55877770
N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carboxamide (PubChem CID 55877770) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55877770 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-1-(3-chlorophenyl)-5-propan-2-ylpyrazole-4-carboxamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)c2cnn(-c3cccc(Cl)c3)c2C(C)C)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N4O3/c1-14(2)21-19(13-27-29(21)17-6-4-5-15(24)11-17)23(31)28-16-7-8-18(20(25)12-16)22(30)26-9-10-32-3/h4-8,11-14H,9-10H2,1-3H3,(H,26,30)(H,28,31) |
| InChIKey | QYEVIMGLPNQQQK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|