C21H18ClN3O — CID 31812512
1-(3-chlorophenyl)-N-(3-ethynylphenyl)-5-propan-2-ylpyrazole-4-carboxamide (PubChem CID 31812512) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(3-ethynylphenyl)-5-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(3-ethynylphenyl)-5-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31812512 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(3-ethynylphenyl)-5-propan-2-ylpyrazole-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cnn(-c3cccc(Cl)c3)c2C(C)C)c1 |
| InChI | InChI=1S/C21H18ClN3O/c1-4-15-7-5-9-17(11-15)24-21(26)19-13-23-25(20(19)14(2)3)18-10-6-8-16(22)12-18/h1,5-14H,2-3H3,(H,24,26) |
| InChIKey | XDFPMDFFEHGMQD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|