C27H36N2O2 — CID 11853328
(3R)-2-octanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11853328) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (3R)-2-octanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-octanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11853328 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (3R)-2-octanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCCCC(=O)N1Cc2ccccc2C[C@@H]1C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H36N2O2/c1-5-6-7-8-9-14-25(30)29-18-23-13-11-10-12-22(23)17-24(29)27(31)28-26-20(3)15-19(2)16-21(26)4/h10-13,15-16,24H,5-9,14,17-18H2,1-4H3,(H,28,31)/t24-/m1/s1 |
| InChIKey | BFARMPKQQDFNMO-XMMPIXPASA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|