C27H38ClN3O3 — CID 46873569
(3S)-7-(dimethylamino)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride (PubChem CID 46873569) has the molecular formula C27H38ClN3O3 and a molecular weight of 488.07 g/mol. Its IUPAC name is (3S)-7-(dimethylamino)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride.
| Compound Name | (3S)-7-(dimethylamino)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 46873569 |
| Molecular Formula | C27H38ClN3O3 |
| Molecular Weight | 488.07 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (3S)-7-(dimethylamino)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
| SMILES | CCCCCC(=O)N1Cc2cc(N(C)C)ccc2C[C@H]1C(=O)Nc1cc(C)c(O)c(C)c1C.Cl |
| InChI | InChI=1S/C27H37N3O3.ClH/c1-7-8-9-10-25(31)30-16-21-14-22(29(5)6)12-11-20(21)15-24(30)27(33)28-23-13-17(2)26(32)19(4)18(23)3;/h11-14,24,32H,7-10,15-16H2,1-6H3,(H,28,33);1H/t24-;/m0./s1 |
| InChIKey | YVWMYFMNJYRBIM-JIDHJSLPSA-N |
| XLogP | 5.28 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.07 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|