C25H30ClN3O3 — CID 46873465
(3S)-7-amino-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride (PubChem CID 46873465) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is (3S)-7-amino-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride.
| Compound Name | (3S)-7-amino-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 46873465 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (3S)-7-amino-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(N)ccc2C[C@H]1C(=O)Nc1cc(C)c(O)c(C)c1C.Cl |
| InChI | InChI=1S/C25H29N3O3.ClH/c1-5-6-7-8-23(29)28-14-19-12-20(26)10-9-18(19)13-22(28)25(31)27-21-11-15(2)24(30)17(4)16(21)3;/h5-12,22,30H,13-14,26H2,1-4H3,(H,27,31);1H/b6-5+,8-7+;/t22-;/m0./s1 |
| InChIKey | LQIMGPWTJKZZGC-NMHCQKIJSA-N |
| XLogP | 4.35 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|