C31H43N3O4 — CID 11854084
(3S)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-7-(2-pyrrolidin-1-ylethoxy)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11854084) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is (3S)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-7-(2-pyrrolidin-1-ylethoxy)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-7-(2-pyrrolidin-1-ylethoxy)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11854084 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | (3S)-2-hexanoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-7-(2-pyrrolidin-1-ylethoxy)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCC(=O)N1Cc2cc(OCCN3CCCC3)ccc2C[C@H]1C(=O)Nc1cc(C)c(O)c(C)c1C |
| InChI | InChI=1S/C31H43N3O4/c1-5-6-7-10-29(35)34-20-25-18-26(38-16-15-33-13-8-9-14-33)12-11-24(25)19-28(34)31(37)32-27-17-21(2)30(36)23(4)22(27)3/h11-12,17-18,28,36H,5-10,13-16,19-20H2,1-4H3,(H,32,37)/t28-/m0/s1 |
| InChIKey | GUMHTJXGPDPVIU-NDEPHWFRSA-N |
| XLogP | 5.26 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|