C24H37NO4 — CID 20673214
tert-butyl 3-acetyl-7-octoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 20673214) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is tert-butyl 3-acetyl-7-octoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 3-acetyl-7-octoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 20673214 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | tert-butyl 3-acetyl-7-octoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCCCCCCCOc1ccc2c(c1)CN(C(=O)OC(C)(C)C)C(C(C)=O)C2 |
| InChI | InChI=1S/C24H37NO4/c1-6-7-8-9-10-11-14-28-21-13-12-19-16-22(18(2)26)25(17-20(19)15-21)23(27)29-24(3,4)5/h12-13,15,22H,6-11,14,16-17H2,1-5H3 |
| InChIKey | SUYNJHZBAQPRLL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|