C20H33NO — CID 71030229
2-[(2S)-6-heptoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-amine (PubChem CID 71030229) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 2-[(2S)-6-heptoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-amine.
| Compound Name | 2-[(2S)-6-heptoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 71030229 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 2-[(2S)-6-heptoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propan-2-amine |
| SMILES | CCCCCCCOc1ccc2c(c1)CC[C@H](C(C)(C)N)C2 |
| InChI | InChI=1S/C20H33NO/c1-4-5-6-7-8-13-22-19-12-10-16-14-18(20(2,3)21)11-9-17(16)15-19/h10,12,15,18H,4-9,11,13-14,21H2,1-3H3/t18-/m0/s1 |
| InChIKey | XDDGKFVYRGFRHT-SFHVURJKSA-N |
| XLogP | 4.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|